C21H17N5O7S2 — CID 170913315
(Z)-2-cyano-3-[3-methoxy-4-[(2-nitrophenyl)methoxy]phenyl]-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 170913315) has the molecular formula C21H17N5O7S2 and a molecular weight of 515.53 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3-methoxy-4-[(2-nitrophenyl)methoxy]phenyl]-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3-methoxy-4-[(2-nitrophenyl)methoxy]phenyl]-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170913315 |
| Molecular Formula | C21H17N5O7S2 |
| Molecular Weight | 515.53 g/mol |
| Exact Mass | 515.06 |
| IUPAC Name | (Z)-2-cyano-3-[3-methoxy-4-[(2-nitrophenyl)methoxy]phenyl]-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2nnc(S(C)(=O)=O)s2)ccc1OCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H17N5O7S2/c1-32-18-10-13(7-8-17(18)33-12-14-5-3-4-6-16(14)26(28)29)9-15(11-22)19(27)23-20-24-25-21(34-20)35(2,30)31/h3-10H,12H2,1-2H3,(H,23,24,27)/b15-9- |
| InChIKey | RJQXALLWCWBICF-DHDCSXOGSA-N |
| XLogP | 2.98 |
| TPSA | 174.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|