C22H18N4O6S2 — CID 170913390
[4-[(Z)-2-cyano-3-[(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] benzoate (PubChem CID 170913390) has the molecular formula C22H18N4O6S2 and a molecular weight of 498.54 g/mol. Its IUPAC name is [4-[(Z)-2-cyano-3-[(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] benzoate.
| Compound Name | [4-[(Z)-2-cyano-3-[(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] benzoate |
|---|---|
| PubChem CID | 170913390 |
| Molecular Formula | C22H18N4O6S2 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | [4-[(Z)-2-cyano-3-[(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] benzoate |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2nnc(S(C)(=O)=O)s2)ccc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H18N4O6S2/c1-3-31-18-12-14(9-10-17(18)32-20(28)15-7-5-4-6-8-15)11-16(13-23)19(27)24-21-25-26-22(33-21)34(2,29)30/h4-12H,3H2,1-2H3,(H,24,25,27)/b16-11- |
| InChIKey | BPKHJJRPCDKCHN-WJDWOHSUSA-N |
| XLogP | 3.11 |
| TPSA | 148.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|