C22H19ClN4O5S2 — CID 170913135
(Z)-3-(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)-2-cyano-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 170913135) has the molecular formula C22H19ClN4O5S2 and a molecular weight of 519.00 g/mol. Its IUPAC name is (Z)-3-(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)-2-cyano-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (Z)-3-(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)-2-cyano-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170913135 |
| Molecular Formula | C22H19ClN4O5S2 |
| Molecular Weight | 519.00 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | (Z)-3-(3-chloro-5-ethoxy-4-phenylmethoxyphenyl)-2-cyano-N-(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2nnc(S(C)(=O)=O)s2)cc(Cl)c1OCc1ccccc1 |
| InChI | InChI=1S/C22H19ClN4O5S2/c1-3-31-18-11-15(10-17(23)19(18)32-13-14-7-5-4-6-8-14)9-16(12-24)20(28)25-21-26-27-22(33-21)34(2,29)30/h4-11H,3,13H2,1-2H3,(H,25,26,28)/b16-9- |
| InChIKey | DFJGMHCKLUWLRY-SXGWCWSVSA-N |
| XLogP | 4.12 |
| TPSA | 131.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.00 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|