C26H20ClFN2O5 — CID 124550113
3-[[(Z)-3-[3-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]-2-cyanoprop-2-enoyl]amino]benzoic acid (PubChem CID 124550113) has the molecular formula C26H20ClFN2O5 and a molecular weight of 494.91 g/mol. Its IUPAC name is 3-[[(Z)-3-[3-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]-2-cyanoprop-2-enoyl]amino]benzoic acid.
| Compound Name | 3-[[(Z)-3-[3-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]-2-cyanoprop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 124550113 |
| Molecular Formula | C26H20ClFN2O5 |
| Molecular Weight | 494.91 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 3-[[(Z)-3-[3-chloro-5-ethoxy-4-[(4-fluorophenyl)methoxy]phenyl]-2-cyanoprop-2-enoyl]amino]benzoic acid |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2cccc(C(=O)O)c2)cc(Cl)c1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C26H20ClFN2O5/c1-2-34-23-12-17(11-22(27)24(23)35-15-16-6-8-20(28)9-7-16)10-19(14-29)25(31)30-21-5-3-4-18(13-21)26(32)33/h3-13H,2,15H2,1H3,(H,30,31)(H,32,33)/b19-10- |
| InChIKey | RUDPFAXNCIWVCQ-GRSHGNNSSA-N |
| XLogP | 5.70 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.91 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|