C21H18N2O7 — CID 4557211
3-[[3-[4-(carboxymethoxy)-3-ethoxyphenyl]-2-cyanoprop-2-enoyl]amino]benzoic acid (PubChem CID 4557211) has the molecular formula C21H18N2O7 and a molecular weight of 410.38 g/mol. Its IUPAC name is 3-[[3-[4-(carboxymethoxy)-3-ethoxyphenyl]-2-cyanoprop-2-enoyl]amino]benzoic acid.
| Compound Name | 3-[[3-[4-(carboxymethoxy)-3-ethoxyphenyl]-2-cyanoprop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 4557211 |
| Molecular Formula | C21H18N2O7 |
| Molecular Weight | 410.38 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 3-[[3-[4-(carboxymethoxy)-3-ethoxyphenyl]-2-cyanoprop-2-enoyl]amino]benzoic acid |
| SMILES | CCOc1cc(C=C(C#N)C(=O)Nc2cccc(C(=O)O)c2)ccc1OCC(=O)O |
| InChI | InChI=1S/C21H18N2O7/c1-2-29-18-9-13(6-7-17(18)30-12-19(24)25)8-15(11-22)20(26)23-16-5-3-4-14(10-16)21(27)28/h3-10H,2,12H2,1H3,(H,23,26)(H,24,25)(H,27,28) |
| InChIKey | ZBSUMFQYNMOGBY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 145.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|