C21H16ClF3N2O5 — CID 126056535
2-[2-chloro-4-[(E)-2-cyano-3-oxo-3-[3-(trifluoromethyl)anilino]prop-1-enyl]-6-ethoxyphenoxy]acetic acid (PubChem CID 126056535) has the molecular formula C21H16ClF3N2O5 and a molecular weight of 468.82 g/mol. Its IUPAC name is 2-[2-chloro-4-[(E)-2-cyano-3-oxo-3-[3-(trifluoromethyl)anilino]prop-1-enyl]-6-ethoxyphenoxy]acetic acid.
| Compound Name | 2-[2-chloro-4-[(E)-2-cyano-3-oxo-3-[3-(trifluoromethyl)anilino]prop-1-enyl]-6-ethoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 126056535 |
| Molecular Formula | C21H16ClF3N2O5 |
| Molecular Weight | 468.82 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | 2-[2-chloro-4-[(E)-2-cyano-3-oxo-3-[3-(trifluoromethyl)anilino]prop-1-enyl]-6-ethoxyphenoxy]acetic acid |
| SMILES | CCOc1cc(/C=C(\C#N)C(=O)Nc2cccc(C(F)(F)F)c2)cc(Cl)c1OCC(=O)O |
| InChI | InChI=1S/C21H16ClF3N2O5/c1-2-31-17-8-12(7-16(22)19(17)32-11-18(28)29)6-13(10-26)20(30)27-15-5-3-4-14(9-15)21(23,24)25/h3-9H,2,11H2,1H3,(H,27,30)(H,28,29)/b13-6+ |
| InChIKey | ZALYXTAFDGZUED-AWNIVKPZSA-N |
| XLogP | 4.77 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.82 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|