C29H25F3IN3O4 — CID 126267667
(E)-2-cyano-3-[4-[2-(2,3-dimethylanilino)-2-oxoethoxy]-3-ethoxy-5-iodophenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 126267667) has the molecular formula C29H25F3IN3O4 and a molecular weight of 663.43 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-[2-(2,3-dimethylanilino)-2-oxoethoxy]-3-ethoxy-5-iodophenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[4-[2-(2,3-dimethylanilino)-2-oxoethoxy]-3-ethoxy-5-iodophenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126267667 |
| Molecular Formula | C29H25F3IN3O4 |
| Molecular Weight | 663.43 g/mol |
| Exact Mass | 663.08 |
| IUPAC Name | (E)-2-cyano-3-[4-[2-(2,3-dimethylanilino)-2-oxoethoxy]-3-ethoxy-5-iodophenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C(\C#N)C(=O)Nc2cccc(C(F)(F)F)c2)cc(I)c1OCC(=O)Nc1cccc(C)c1C |
| InChI | InChI=1S/C29H25F3IN3O4/c1-4-39-25-13-19(11-20(15-34)28(38)35-22-9-6-8-21(14-22)29(30,31)32)12-23(33)27(25)40-16-26(37)36-24-10-5-7-17(2)18(24)3/h5-14H,4,16H2,1-3H3,(H,35,38)(H,36,37)/b20-11+ |
| InChIKey | DHOMSGIMPHQFIU-RGVLZGJSSA-N |
| XLogP | 6.89 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.43 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|