C22H18F3IN2O5 — CID 126243529
methyl 2-[4-[(Z)-2-cyano-3-oxo-3-[3-(trifluoromethyl)anilino]prop-1-enyl]-2-ethoxy-6-iodophenoxy]acetate (PubChem CID 126243529) has the molecular formula C22H18F3IN2O5 and a molecular weight of 574.29 g/mol. Its IUPAC name is methyl 2-[4-[(Z)-2-cyano-3-oxo-3-[3-(trifluoromethyl)anilino]prop-1-enyl]-2-ethoxy-6-iodophenoxy]acetate.
| Compound Name | methyl 2-[4-[(Z)-2-cyano-3-oxo-3-[3-(trifluoromethyl)anilino]prop-1-enyl]-2-ethoxy-6-iodophenoxy]acetate |
|---|---|
| PubChem CID | 126243529 |
| Molecular Formula | C22H18F3IN2O5 |
| Molecular Weight | 574.29 g/mol |
| Exact Mass | 574.02 |
| IUPAC Name | methyl 2-[4-[(Z)-2-cyano-3-oxo-3-[3-(trifluoromethyl)anilino]prop-1-enyl]-2-ethoxy-6-iodophenoxy]acetate |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2cccc(C(F)(F)F)c2)cc(I)c1OCC(=O)OC |
| InChI | InChI=1S/C22H18F3IN2O5/c1-3-32-18-9-13(8-17(26)20(18)33-12-19(29)31-2)7-14(11-27)21(30)28-16-6-4-5-15(10-16)22(23,24)25/h4-10H,3,12H2,1-2H3,(H,28,30)/b14-7- |
| InChIKey | WBFBOLOXULEDFQ-AUWJEWJLSA-N |
| XLogP | 4.81 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.29 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|