C28H23F3IN3O4 — CID 126258245
(E)-2-cyano-3-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 126258245) has the molecular formula C28H23F3IN3O4 and a molecular weight of 649.41 g/mol. Its IUPAC name is (E)-2-cyano-3-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126258245 |
| Molecular Formula | C28H23F3IN3O4 |
| Molecular Weight | 649.41 g/mol |
| Exact Mass | 649.07 |
| IUPAC Name | (E)-2-cyano-3-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-iodo-5-methoxyphenyl]-N-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C(\C#N)C(=O)Nc2cccc(C(F)(F)F)c2)cc(I)c1OCC(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C28H23F3IN3O4/c1-16-7-8-23(17(2)9-16)35-25(36)15-39-26-22(32)11-18(12-24(26)38-3)10-19(14-33)27(37)34-21-6-4-5-20(13-21)28(29,30)31/h4-13H,15H2,1-3H3,(H,34,37)(H,35,36)/b19-10+ |
| InChIKey | RXJUTSWAGFBMJE-VXLYETTFSA-N |
| XLogP | 6.50 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.41 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|