C28H25IN4O6 — CID 126266214
(Z)-2-cyano-3-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-ethoxy-5-iodophenyl]-N-(3-nitrophenyl)prop-2-enamide (PubChem CID 126266214) has the molecular formula C28H25IN4O6 and a molecular weight of 640.43 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-ethoxy-5-iodophenyl]-N-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-ethoxy-5-iodophenyl]-N-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126266214 |
| Molecular Formula | C28H25IN4O6 |
| Molecular Weight | 640.43 g/mol |
| Exact Mass | 640.08 |
| IUPAC Name | (Z)-2-cyano-3-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-ethoxy-5-iodophenyl]-N-(3-nitrophenyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2cccc([N+](=O)[O-])c2)cc(I)c1OCC(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C28H25IN4O6/c1-4-38-25-13-19(11-20(15-30)28(35)31-21-6-5-7-22(14-21)33(36)37)12-23(29)27(25)39-16-26(34)32-24-9-8-17(2)10-18(24)3/h5-14H,4,16H2,1-3H3,(H,31,35)(H,32,34)/b20-11- |
| InChIKey | JTZDQOIZDMQVKK-JAIQZWGSSA-N |
| XLogP | 5.78 |
| TPSA | 143.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.43 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|