C27H24N4O6 — CID 126274124
(Z)-2-cyano-3-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]-N-(3-nitrophenyl)prop-2-enamide (PubChem CID 126274124) has the molecular formula C27H24N4O6 and a molecular weight of 500.51 g/mol. Its IUPAC name is (Z)-2-cyano-3-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]-N-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]-N-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126274124 |
| Molecular Formula | C27H24N4O6 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | (Z)-2-cyano-3-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-methoxyphenyl]-N-(3-nitrophenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2cccc([N+](=O)[O-])c2)ccc1OCC(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C27H24N4O6/c1-17-7-9-23(18(2)11-17)30-26(32)16-37-24-10-8-19(13-25(24)36-3)12-20(15-28)27(33)29-21-5-4-6-22(14-21)31(34)35/h4-14H,16H2,1-3H3,(H,29,33)(H,30,32)/b20-12- |
| InChIKey | YHGPBYTZEZRWRR-NDENLUEZSA-N |
| XLogP | 4.78 |
| TPSA | 143.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|