C26H20Br2N4O5 — CID 126261637
(Z)-2-cyano-3-[3,5-dibromo-4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]-N-(3-nitrophenyl)prop-2-enamide (PubChem CID 126261637) has the molecular formula C26H20Br2N4O5 and a molecular weight of 628.28 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3,5-dibromo-4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]-N-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3,5-dibromo-4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]-N-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126261637 |
| Molecular Formula | C26H20Br2N4O5 |
| Molecular Weight | 628.28 g/mol |
| Exact Mass | 625.98 |
| IUPAC Name | (Z)-2-cyano-3-[3,5-dibromo-4-[2-(2,5-dimethylanilino)-2-oxoethoxy]phenyl]-N-(3-nitrophenyl)prop-2-enamide |
| SMILES | Cc1ccc(C)c(NC(=O)COc2c(Br)cc(/C=C(/C#N)C(=O)Nc3cccc([N+](=O)[O-])c3)cc2Br)c1 |
| InChI | InChI=1S/C26H20Br2N4O5/c1-15-6-7-16(2)23(8-15)31-24(33)14-37-25-21(27)10-17(11-22(25)28)9-18(13-29)26(34)30-19-4-3-5-20(12-19)32(35)36/h3-12H,14H2,1-2H3,(H,30,34)(H,31,33)/b18-9- |
| InChIKey | ZXSWXMLYLLSFTQ-NVMNQCDNSA-N |
| XLogP | 6.30 |
| TPSA | 134.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.28 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|