C29H28IN3O4 — CID 126053155
(E)-2-cyano-N-(2,3-dimethylphenyl)-3-[3-ethoxy-5-iodo-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]prop-2-enamide (PubChem CID 126053155) has the molecular formula C29H28IN3O4 and a molecular weight of 609.46 g/mol. Its IUPAC name is (E)-2-cyano-N-(2,3-dimethylphenyl)-3-[3-ethoxy-5-iodo-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-N-(2,3-dimethylphenyl)-3-[3-ethoxy-5-iodo-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 126053155 |
| Molecular Formula | C29H28IN3O4 |
| Molecular Weight | 609.46 g/mol |
| Exact Mass | 609.11 |
| IUPAC Name | (E)-2-cyano-N-(2,3-dimethylphenyl)-3-[3-ethoxy-5-iodo-4-[2-(3-methylanilino)-2-oxoethoxy]phenyl]prop-2-enamide |
| SMILES | CCOc1cc(/C=C(\C#N)C(=O)Nc2cccc(C)c2C)cc(I)c1OCC(=O)Nc1cccc(C)c1 |
| InChI | InChI=1S/C29H28IN3O4/c1-5-36-26-15-21(13-22(16-31)29(35)33-25-11-7-9-19(3)20(25)4)14-24(30)28(26)37-17-27(34)32-23-10-6-8-18(2)12-23/h6-15H,5,17H2,1-4H3,(H,32,34)(H,33,35)/b22-13+ |
| InChIKey | LTDZADOJECWMBB-LPYMAVHISA-N |
| XLogP | 6.18 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.46 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|