C29H28IN3O5 — CID 126262699
(E)-2-cyano-3-[3-ethoxy-5-iodo-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]-N-(4-ethoxyphenyl)prop-2-enamide (PubChem CID 126262699) has the molecular formula C29H28IN3O5 and a molecular weight of 625.46 g/mol. Its IUPAC name is (E)-2-cyano-3-[3-ethoxy-5-iodo-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]-N-(4-ethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[3-ethoxy-5-iodo-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]-N-(4-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126262699 |
| Molecular Formula | C29H28IN3O5 |
| Molecular Weight | 625.46 g/mol |
| Exact Mass | 625.11 |
| IUPAC Name | (E)-2-cyano-3-[3-ethoxy-5-iodo-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]-N-(4-ethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccc(NC(=O)/C(C#N)=C/c2cc(I)c(OCC(=O)Nc3ccccc3C)c(OCC)c2)cc1 |
| InChI | InChI=1S/C29H28IN3O5/c1-4-36-23-12-10-22(11-13-23)32-29(35)21(17-31)14-20-15-24(30)28(26(16-20)37-5-2)38-18-27(34)33-25-9-7-6-8-19(25)3/h6-16H,4-5,18H2,1-3H3,(H,32,35)(H,33,34)/b21-14+ |
| InChIKey | OZJZFKNZYCSPPD-KGENOOAVSA-N |
| XLogP | 5.96 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.46 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|