C30H28IN3O6 — CID 126261293
methyl 4-[[(Z)-2-cyano-3-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-ethoxy-5-iodophenyl]prop-2-enoyl]amino]benzoate (PubChem CID 126261293) has the molecular formula C30H28IN3O6 and a molecular weight of 653.47 g/mol. Its IUPAC name is methyl 4-[[(Z)-2-cyano-3-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-ethoxy-5-iodophenyl]prop-2-enoyl]amino]benzoate.
| Compound Name | methyl 4-[[(Z)-2-cyano-3-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-ethoxy-5-iodophenyl]prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 126261293 |
| Molecular Formula | C30H28IN3O6 |
| Molecular Weight | 653.47 g/mol |
| Exact Mass | 653.10 |
| IUPAC Name | methyl 4-[[(Z)-2-cyano-3-[4-[2-(2,4-dimethylanilino)-2-oxoethoxy]-3-ethoxy-5-iodophenyl]prop-2-enoyl]amino]benzoate |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2ccc(C(=O)OC)cc2)cc(I)c1OCC(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C30H28IN3O6/c1-5-39-26-15-20(13-22(16-32)29(36)33-23-9-7-21(8-10-23)30(37)38-4)14-24(31)28(26)40-17-27(35)34-25-11-6-18(2)12-19(25)3/h6-15H,5,17H2,1-4H3,(H,33,36)(H,34,35)/b22-13- |
| InChIKey | HFBZPTHXKUZCSJ-XKZIYDEJSA-N |
| XLogP | 5.66 |
| TPSA | 126.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.47 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|