C25H20N2O5 — CID 94842961
3-[[4-[(Z)-3-anilino-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenoxy]methyl]benzoic acid (PubChem CID 94842961) has the molecular formula C25H20N2O5 and a molecular weight of 428.44 g/mol. Its IUPAC name is 3-[[4-[(Z)-3-anilino-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 3-[[4-[(Z)-3-anilino-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 94842961 |
| Molecular Formula | C25H20N2O5 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 3-[[4-[(Z)-3-anilino-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2ccccc2)ccc1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C25H20N2O5/c1-31-23-14-17(12-20(15-26)24(28)27-21-8-3-2-4-9-21)10-11-22(23)32-16-18-6-5-7-19(13-18)25(29)30/h2-14H,16H2,1H3,(H,27,28)(H,29,30)/b20-12- |
| InChIKey | BAAQORNHBIMQCH-NDENLUEZSA-N |
| XLogP | 4.52 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|