C25H18F3NO3 — CID 6174511
(E)-2-benzoyl-3-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enenitrile (PubChem CID 6174511) has the molecular formula C25H18F3NO3 and a molecular weight of 437.42 g/mol. Its IUPAC name is (E)-2-benzoyl-3-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enenitrile.
| Compound Name | (E)-2-benzoyl-3-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 6174511 |
| Molecular Formula | C25H18F3NO3 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | (E)-2-benzoyl-3-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enenitrile |
| SMILES | COc1cc(/C=C(\C#N)C(=O)c2ccccc2)ccc1OCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H18F3NO3/c1-31-23-14-17(12-20(15-29)24(30)19-7-3-2-4-8-19)10-11-22(23)32-16-18-6-5-9-21(13-18)25(26,27)28/h2-14H,16H2,1H3/b20-12+ |
| InChIKey | PMQLUVUZYZQFFU-UDWIEESQSA-N |
| XLogP | 6.08 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|