C22H18F3NO4 — CID 43012175
prop-2-enyl (E)-2-cyano-3-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enoate (PubChem CID 43012175) has the molecular formula C22H18F3NO4 and a molecular weight of 417.38 g/mol. Its IUPAC name is prop-2-enyl (E)-2-cyano-3-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enoate.
| Compound Name | prop-2-enyl (E)-2-cyano-3-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 43012175 |
| Molecular Formula | C22H18F3NO4 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | prop-2-enyl (E)-2-cyano-3-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enoate |
| SMILES | C=CCOC(=O)/C(C#N)=C/c1ccc(OCc2cccc(C(F)(F)F)c2)c(OC)c1 |
| InChI | InChI=1S/C22H18F3NO4/c1-3-9-29-21(27)17(13-26)10-15-7-8-19(20(12-15)28-2)30-14-16-5-4-6-18(11-16)22(23,24)25/h3-8,10-12H,1,9,14H2,2H3/b17-10+ |
| InChIKey | YNBAYBCJEUKINW-LICLKQGHSA-N |
| XLogP | 4.93 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|