C14H13NO4 — CID 7972729
prop-2-enyl (E)-2-cyano-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate (PubChem CID 7972729) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is prop-2-enyl (E)-2-cyano-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate.
| Compound Name | prop-2-enyl (E)-2-cyano-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7972729 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | prop-2-enyl (E)-2-cyano-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate |
| SMILES | C=CCOC(=O)/C(C#N)=C/c1ccc(OC)c(O)c1 |
| InChI | InChI=1S/C14H13NO4/c1-3-6-19-14(17)11(9-15)7-10-4-5-13(18-2)12(16)8-10/h3-5,7-8,16H,1,6H2,2H3/b11-7+ |
| InChIKey | CFWHYBXAHBESHO-YRNVUSSQSA-N |
| XLogP | 2.04 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|