C17H15NO4S — CID 54457878
2-thiophen-2-ylethyl 2-cyano-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate (PubChem CID 54457878) has the molecular formula C17H15NO4S and a molecular weight of 329.38 g/mol. Its IUPAC name is 2-thiophen-2-ylethyl 2-cyano-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate.
| Compound Name | 2-thiophen-2-ylethyl 2-cyano-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 54457878 |
| Molecular Formula | C17H15NO4S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 2-thiophen-2-ylethyl 2-cyano-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(C=C(C#N)C(=O)OCCc2cccs2)cc1O |
| InChI | InChI=1S/C17H15NO4S/c1-21-16-5-4-12(10-15(16)19)9-13(11-18)17(20)22-7-6-14-3-2-8-23-14/h2-5,8-10,19H,6-7H2,1H3 |
| InChIKey | WZMPUIXAVOAHCT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|