C19H17NO6S — CID 2688492
[4-[(E)-2-cyano-3-(2-methoxyethoxy)-3-oxoprop-1-enyl]-2-methoxyphenyl] thiophene-2-carboxylate (PubChem CID 2688492) has the molecular formula C19H17NO6S and a molecular weight of 387.41 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-(2-methoxyethoxy)-3-oxoprop-1-enyl]-2-methoxyphenyl] thiophene-2-carboxylate.
| Compound Name | [4-[(E)-2-cyano-3-(2-methoxyethoxy)-3-oxoprop-1-enyl]-2-methoxyphenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 2688492 |
| Molecular Formula | C19H17NO6S |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.08 |
| IUPAC Name | [4-[(E)-2-cyano-3-(2-methoxyethoxy)-3-oxoprop-1-enyl]-2-methoxyphenyl] thiophene-2-carboxylate |
| SMILES | COCCOC(=O)/C(C#N)=C/c1ccc(OC(=O)c2cccs2)c(OC)c1 |
| InChI | InChI=1S/C19H17NO6S/c1-23-7-8-25-18(21)14(12-20)10-13-5-6-15(16(11-13)24-2)26-19(22)17-4-3-9-27-17/h3-6,9-11H,7-8H2,1-2H3/b14-10+ |
| InChIKey | JEETWCCGLCGEGA-GXDHUFHOSA-N |
| XLogP | 3.07 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|