C22H15BrN2O4S — CID 60528913
[4-[(Z)-3-(2-bromoanilino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenyl] thiophene-2-carboxylate (PubChem CID 60528913) has the molecular formula C22H15BrN2O4S and a molecular weight of 483.34 g/mol. Its IUPAC name is [4-[(Z)-3-(2-bromoanilino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenyl] thiophene-2-carboxylate.
| Compound Name | [4-[(Z)-3-(2-bromoanilino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 60528913 |
| Molecular Formula | C22H15BrN2O4S |
| Molecular Weight | 483.34 g/mol |
| Exact Mass | 481.99 |
| IUPAC Name | [4-[(Z)-3-(2-bromoanilino)-2-cyano-3-oxoprop-1-enyl]-2-methoxyphenyl] thiophene-2-carboxylate |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2ccccc2Br)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C22H15BrN2O4S/c1-28-19-12-14(8-9-18(19)29-22(27)20-7-4-10-30-20)11-15(13-24)21(26)25-17-6-3-2-5-16(17)23/h2-12H,1H3,(H,25,26)/b15-11- |
| InChIKey | IPCRWIXLGSRMHE-PTNGSMBKSA-N |
| XLogP | 5.28 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.34 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|