C22H19N5O4S2 — CID 170911310
[4-[(Z)-2-cyano-3-oxo-3-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)amino]prop-1-enyl]-2-methoxyphenyl] thiophene-2-carboxylate (PubChem CID 170911310) has the molecular formula C22H19N5O4S2 and a molecular weight of 481.56 g/mol. Its IUPAC name is [4-[(Z)-2-cyano-3-oxo-3-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)amino]prop-1-enyl]-2-methoxyphenyl] thiophene-2-carboxylate.
| Compound Name | [4-[(Z)-2-cyano-3-oxo-3-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)amino]prop-1-enyl]-2-methoxyphenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 170911310 |
| Molecular Formula | C22H19N5O4S2 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.09 |
| IUPAC Name | [4-[(Z)-2-cyano-3-oxo-3-[(5-pyrrolidin-1-yl-1,3,4-thiadiazol-2-yl)amino]prop-1-enyl]-2-methoxyphenyl] thiophene-2-carboxylate |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2nnc(N3CCCC3)s2)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C22H19N5O4S2/c1-30-17-12-14(6-7-16(17)31-20(29)18-5-4-10-32-18)11-15(13-23)19(28)24-21-25-26-22(33-21)27-8-2-3-9-27/h4-7,10-12H,2-3,8-9H2,1H3,(H,24,25,28)/b15-11- |
| InChIKey | RMSNGLFQHJSOFN-PTNGSMBKSA-N |
| XLogP | 3.97 |
| TPSA | 117.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|