C24H23N5O5S — CID 170911547
[4-[(Z)-2-cyano-3-oxo-3-[(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)amino]prop-1-enyl]-2-ethoxyphenyl] furan-2-carboxylate (PubChem CID 170911547) has the molecular formula C24H23N5O5S and a molecular weight of 493.55 g/mol. Its IUPAC name is [4-[(Z)-2-cyano-3-oxo-3-[(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)amino]prop-1-enyl]-2-ethoxyphenyl] furan-2-carboxylate.
| Compound Name | [4-[(Z)-2-cyano-3-oxo-3-[(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)amino]prop-1-enyl]-2-ethoxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 170911547 |
| Molecular Formula | C24H23N5O5S |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | [4-[(Z)-2-cyano-3-oxo-3-[(5-piperidin-1-yl-1,3,4-thiadiazol-2-yl)amino]prop-1-enyl]-2-ethoxyphenyl] furan-2-carboxylate |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2nnc(N3CCCCC3)s2)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C24H23N5O5S/c1-2-32-20-14-16(8-9-18(20)34-22(31)19-7-6-12-33-19)13-17(15-25)21(30)26-23-27-28-24(35-23)29-10-4-3-5-11-29/h6-9,12-14H,2-5,10-11H2,1H3,(H,26,27,30)/b17-13- |
| InChIKey | ZTSWBWWCFBCZBI-LGMDPLHJSA-N |
| XLogP | 4.28 |
| TPSA | 130.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|