C26H21N3O5S — CID 6176374
[4-[(E)-2-cyano-3-[(5,6-dimethyl-1,3-benzothiazol-2-yl)amino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] furan-2-carboxylate (PubChem CID 6176374) has the molecular formula C26H21N3O5S and a molecular weight of 487.54 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-[(5,6-dimethyl-1,3-benzothiazol-2-yl)amino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] furan-2-carboxylate.
| Compound Name | [4-[(E)-2-cyano-3-[(5,6-dimethyl-1,3-benzothiazol-2-yl)amino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 6176374 |
| Molecular Formula | C26H21N3O5S |
| Molecular Weight | 487.54 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | [4-[(E)-2-cyano-3-[(5,6-dimethyl-1,3-benzothiazol-2-yl)amino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] furan-2-carboxylate |
| SMILES | CCOc1cc(/C=C(\C#N)C(=O)Nc2nc3cc(C)c(C)cc3s2)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C26H21N3O5S/c1-4-32-22-13-17(7-8-20(22)34-25(31)21-6-5-9-33-21)12-18(14-27)24(30)29-26-28-19-10-15(2)16(3)11-23(19)35-26/h5-13H,4H2,1-3H3,(H,28,29,30)/b18-12+ |
| InChIKey | VZGOPWXJURVBMY-LDADJPATSA-N |
| XLogP | 5.67 |
| TPSA | 114.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|