C19H13ClN4O4S2 — CID 171331844
[2-chloro-4-[2-cyano-3-[(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]phenyl] furan-2-carboxylate (PubChem CID 171331844) has the molecular formula C19H13ClN4O4S2 and a molecular weight of 460.92 g/mol. Its IUPAC name is [2-chloro-4-[2-cyano-3-[(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]phenyl] furan-2-carboxylate.
| Compound Name | [2-chloro-4-[2-cyano-3-[(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 171331844 |
| Molecular Formula | C19H13ClN4O4S2 |
| Molecular Weight | 460.92 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | [2-chloro-4-[2-cyano-3-[(3-ethylsulfanyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]phenyl] furan-2-carboxylate |
| SMILES | CCSc1nsc(NC(=O)C(C#N)=Cc2ccc(OC(=O)c3ccco3)c(Cl)c2)n1 |
| InChI | InChI=1S/C19H13ClN4O4S2/c1-2-29-19-23-18(30-24-19)22-16(25)12(10-21)8-11-5-6-14(13(20)9-11)28-17(26)15-4-3-7-27-15/h3-9H,2H2,1H3,(H,22,23,24,25) |
| InChIKey | VABHJTWEPHAJRC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 118.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.92 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|