C21H17BrN4O5S2 — CID 171331884
[2-bromo-4-[2-cyano-3-oxo-3-[(3-propan-2-ylsulfanyl-1,2,4-thiadiazol-5-yl)amino]prop-1-enyl]-6-methoxyphenyl] furan-2-carboxylate (PubChem CID 171331884) has the molecular formula C21H17BrN4O5S2 and a molecular weight of 549.43 g/mol. Its IUPAC name is [2-bromo-4-[2-cyano-3-oxo-3-[(3-propan-2-ylsulfanyl-1,2,4-thiadiazol-5-yl)amino]prop-1-enyl]-6-methoxyphenyl] furan-2-carboxylate.
| Compound Name | [2-bromo-4-[2-cyano-3-oxo-3-[(3-propan-2-ylsulfanyl-1,2,4-thiadiazol-5-yl)amino]prop-1-enyl]-6-methoxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 171331884 |
| Molecular Formula | C21H17BrN4O5S2 |
| Molecular Weight | 549.43 g/mol |
| Exact Mass | 547.98 |
| IUPAC Name | [2-bromo-4-[2-cyano-3-oxo-3-[(3-propan-2-ylsulfanyl-1,2,4-thiadiazol-5-yl)amino]prop-1-enyl]-6-methoxyphenyl] furan-2-carboxylate |
| SMILES | COc1cc(C=C(C#N)C(=O)Nc2nc(SC(C)C)ns2)cc(Br)c1OC(=O)c1ccco1 |
| InChI | InChI=1S/C21H17BrN4O5S2/c1-11(2)32-21-25-20(33-26-21)24-18(27)13(10-23)7-12-8-14(22)17(16(9-12)29-3)31-19(28)15-5-4-6-30-15/h4-9,11H,1-3H3,(H,24,25,26,27) |
| InChIKey | FFOUVUGJBBKCFQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 127.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.43 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|