C23H19ClN4O6S2 — CID 170912325
[2-chloro-4-[(Z)-2-cyano-3-oxo-3-[(3-propan-2-ylsulfonyl-1,2,4-thiadiazol-5-yl)amino]prop-1-enyl]-6-methoxyphenyl] benzoate (PubChem CID 170912325) has the molecular formula C23H19ClN4O6S2 and a molecular weight of 547.01 g/mol. Its IUPAC name is [2-chloro-4-[(Z)-2-cyano-3-oxo-3-[(3-propan-2-ylsulfonyl-1,2,4-thiadiazol-5-yl)amino]prop-1-enyl]-6-methoxyphenyl] benzoate.
| Compound Name | [2-chloro-4-[(Z)-2-cyano-3-oxo-3-[(3-propan-2-ylsulfonyl-1,2,4-thiadiazol-5-yl)amino]prop-1-enyl]-6-methoxyphenyl] benzoate |
|---|---|
| PubChem CID | 170912325 |
| Molecular Formula | C23H19ClN4O6S2 |
| Molecular Weight | 547.01 g/mol |
| Exact Mass | 546.04 |
| IUPAC Name | [2-chloro-4-[(Z)-2-cyano-3-oxo-3-[(3-propan-2-ylsulfonyl-1,2,4-thiadiazol-5-yl)amino]prop-1-enyl]-6-methoxyphenyl] benzoate |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2nc(S(=O)(=O)C(C)C)ns2)cc(Cl)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C23H19ClN4O6S2/c1-13(2)36(31,32)23-27-22(35-28-23)26-20(29)16(12-25)9-14-10-17(24)19(18(11-14)33-3)34-21(30)15-7-5-4-6-8-15/h4-11,13H,1-3H3,(H,26,27,28,29)/b16-9- |
| InChIKey | MVPQUHHVGOPFAG-SXGWCWSVSA-N |
| XLogP | 4.15 |
| TPSA | 148.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.01 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|