C20H13BrN4O5S2 — CID 170918451
[2-bromo-4-[(Z)-2-cyano-3-[(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]phenyl] benzoate (PubChem CID 170918451) has the molecular formula C20H13BrN4O5S2 and a molecular weight of 533.39 g/mol. Its IUPAC name is [2-bromo-4-[(Z)-2-cyano-3-[(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]phenyl] benzoate.
| Compound Name | [2-bromo-4-[(Z)-2-cyano-3-[(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]phenyl] benzoate |
|---|---|
| PubChem CID | 170918451 |
| Molecular Formula | C20H13BrN4O5S2 |
| Molecular Weight | 533.39 g/mol |
| Exact Mass | 531.95 |
| IUPAC Name | [2-bromo-4-[(Z)-2-cyano-3-[(3-methylsulfonyl-1,2,4-thiadiazol-5-yl)amino]-3-oxoprop-1-enyl]phenyl] benzoate |
| SMILES | CS(=O)(=O)c1nsc(NC(=O)/C(C#N)=C\c2ccc(OC(=O)c3ccccc3)c(Br)c2)n1 |
| InChI | InChI=1S/C20H13BrN4O5S2/c1-32(28,29)20-24-19(31-25-20)23-17(26)14(11-22)9-12-7-8-16(15(21)10-12)30-18(27)13-5-3-2-4-6-13/h2-10H,1H3,(H,23,24,25,26)/b14-9- |
| InChIKey | SRJUVURZCGICKK-ZROIWOOFSA-N |
| XLogP | 3.47 |
| TPSA | 139.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|