C21H14BrN3O4 — CID 170917091
[2-bromo-4-[(Z)-2-cyano-3-[(5-methyl-1,2-oxazol-3-yl)amino]-3-oxoprop-1-enyl]phenyl] benzoate (PubChem CID 170917091) has the molecular formula C21H14BrN3O4 and a molecular weight of 452.26 g/mol. Its IUPAC name is [2-bromo-4-[(Z)-2-cyano-3-[(5-methyl-1,2-oxazol-3-yl)amino]-3-oxoprop-1-enyl]phenyl] benzoate.
| Compound Name | [2-bromo-4-[(Z)-2-cyano-3-[(5-methyl-1,2-oxazol-3-yl)amino]-3-oxoprop-1-enyl]phenyl] benzoate |
|---|---|
| PubChem CID | 170917091 |
| Molecular Formula | C21H14BrN3O4 |
| Molecular Weight | 452.26 g/mol |
| Exact Mass | 451.02 |
| IUPAC Name | [2-bromo-4-[(Z)-2-cyano-3-[(5-methyl-1,2-oxazol-3-yl)amino]-3-oxoprop-1-enyl]phenyl] benzoate |
| SMILES | Cc1cc(NC(=O)/C(C#N)=C\c2ccc(OC(=O)c3ccccc3)c(Br)c2)no1 |
| InChI | InChI=1S/C21H14BrN3O4/c1-13-9-19(25-29-13)24-20(26)16(12-23)10-14-7-8-18(17(22)11-14)28-21(27)15-5-3-2-4-6-15/h2-11H,1H3,(H,24,25,26)/b16-10- |
| InChIKey | QGRBTPUOERRINA-YBEGLDIGSA-N |
| XLogP | 4.51 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.26 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|