C24H22ClN3O5 — CID 170917420
(Z)-3-[4-[3-(2-chlorophenoxy)propoxy]-3-methoxyphenyl]-2-cyano-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide (PubChem CID 170917420) has the molecular formula C24H22ClN3O5 and a molecular weight of 467.91 g/mol. Its IUPAC name is (Z)-3-[4-[3-(2-chlorophenoxy)propoxy]-3-methoxyphenyl]-2-cyano-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide.
| Compound Name | (Z)-3-[4-[3-(2-chlorophenoxy)propoxy]-3-methoxyphenyl]-2-cyano-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 170917420 |
| Molecular Formula | C24H22ClN3O5 |
| Molecular Weight | 467.91 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | (Z)-3-[4-[3-(2-chlorophenoxy)propoxy]-3-methoxyphenyl]-2-cyano-N-(5-methyl-1,2-oxazol-3-yl)prop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2cc(C)on2)ccc1OCCCOc1ccccc1Cl |
| InChI | InChI=1S/C24H22ClN3O5/c1-16-12-23(28-33-16)27-24(29)18(15-26)13-17-8-9-21(22(14-17)30-2)32-11-5-10-31-20-7-4-3-6-19(20)25/h3-4,6-9,12-14H,5,10-11H2,1-2H3,(H,27,28,29)/b18-13- |
| InChIKey | NMFSULLHCRTIBG-AQTBWJFISA-N |
| XLogP | 5.04 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.91 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|