C21H15BrN4O5S2 — CID 170913876
[2-bromo-4-[(Z)-2-cyano-3-[(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]phenyl] 4-methylbenzoate (PubChem CID 170913876) has the molecular formula C21H15BrN4O5S2 and a molecular weight of 547.41 g/mol. Its IUPAC name is [2-bromo-4-[(Z)-2-cyano-3-[(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]phenyl] 4-methylbenzoate.
| Compound Name | [2-bromo-4-[(Z)-2-cyano-3-[(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 170913876 |
| Molecular Formula | C21H15BrN4O5S2 |
| Molecular Weight | 547.41 g/mol |
| Exact Mass | 545.97 |
| IUPAC Name | [2-bromo-4-[(Z)-2-cyano-3-[(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(/C=C(/C#N)C(=O)Nc3nnc(S(C)(=O)=O)s3)cc2Br)cc1 |
| InChI | InChI=1S/C21H15BrN4O5S2/c1-12-3-6-14(7-4-12)19(28)31-17-8-5-13(10-16(17)22)9-15(11-23)18(27)24-20-25-26-21(32-20)33(2,29)30/h3-10H,1-2H3,(H,24,25,27)/b15-9- |
| InChIKey | LVGPJVXDNMXMFV-DHDCSXOGSA-N |
| XLogP | 3.78 |
| TPSA | 139.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|