C22H20N4O7S3 — CID 171332658
[4-[2-cyano-3-[(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] 4-methylbenzenesulfonate (PubChem CID 171332658) has the molecular formula C22H20N4O7S3 and a molecular weight of 548.62 g/mol. Its IUPAC name is [4-[2-cyano-3-[(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] 4-methylbenzenesulfonate.
| Compound Name | [4-[2-cyano-3-[(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 171332658 |
| Molecular Formula | C22H20N4O7S3 |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 548.05 |
| IUPAC Name | [4-[2-cyano-3-[(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] 4-methylbenzenesulfonate |
| SMILES | CCOc1cc(C=C(C#N)C(=O)Nc2nnc(S(C)(=O)=O)s2)ccc1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H20N4O7S3/c1-4-32-19-12-15(7-10-18(19)33-36(30,31)17-8-5-14(2)6-9-17)11-16(13-23)20(27)24-21-25-26-22(34-21)35(3,28)29/h5-12H,4H2,1-3H3,(H,24,25,27) |
| InChIKey | PRQAHQHIQOGFJS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 165.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|