C19H22N4O7S3 — CID 171333026
[4-[2-cyano-3-[[5-(2-methylpropylsulfonyl)-1,3,4-thiadiazol-2-yl]amino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] methanesulfonate (PubChem CID 171333026) has the molecular formula C19H22N4O7S3 and a molecular weight of 514.61 g/mol. Its IUPAC name is [4-[2-cyano-3-[[5-(2-methylpropylsulfonyl)-1,3,4-thiadiazol-2-yl]amino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] methanesulfonate.
| Compound Name | [4-[2-cyano-3-[[5-(2-methylpropylsulfonyl)-1,3,4-thiadiazol-2-yl]amino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 171333026 |
| Molecular Formula | C19H22N4O7S3 |
| Molecular Weight | 514.61 g/mol |
| Exact Mass | 514.07 |
| IUPAC Name | [4-[2-cyano-3-[[5-(2-methylpropylsulfonyl)-1,3,4-thiadiazol-2-yl]amino]-3-oxoprop-1-enyl]-2-ethoxyphenyl] methanesulfonate |
| SMILES | CCOc1cc(C=C(C#N)C(=O)Nc2nnc(S(=O)(=O)CC(C)C)s2)ccc1OS(C)(=O)=O |
| InChI | InChI=1S/C19H22N4O7S3/c1-5-29-16-9-13(6-7-15(16)30-32(4,25)26)8-14(10-20)17(24)21-18-22-23-19(31-18)33(27,28)11-12(2)3/h6-9,12H,5,11H2,1-4H3,(H,21,22,24) |
| InChIKey | ZWEFDCBYVGLUIX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 165.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.61 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|