C22H17ClN4O6S2 — CID 171332954
[4-[2-cyano-3-[(5-ethylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-chlorobenzoate (PubChem CID 171332954) has the molecular formula C22H17ClN4O6S2 and a molecular weight of 532.99 g/mol. Its IUPAC name is [4-[2-cyano-3-[(5-ethylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-chlorobenzoate.
| Compound Name | [4-[2-cyano-3-[(5-ethylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 171332954 |
| Molecular Formula | C22H17ClN4O6S2 |
| Molecular Weight | 532.99 g/mol |
| Exact Mass | 532.03 |
| IUPAC Name | [4-[2-cyano-3-[(5-ethylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] 2-chlorobenzoate |
| SMILES | CCS(=O)(=O)c1nnc(NC(=O)C(C#N)=Cc2ccc(OC(=O)c3ccccc3Cl)c(OC)c2)s1 |
| InChI | InChI=1S/C22H17ClN4O6S2/c1-3-35(30,31)22-27-26-21(34-22)25-19(28)14(12-24)10-13-8-9-17(18(11-13)32-2)33-20(29)15-6-4-5-7-16(15)23/h4-11H,3H2,1-2H3,(H,25,26,28) |
| InChIKey | HXHBTJQVZUUIEO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 148.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.99 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|