C25H24N4O6S2 — CID 170913554
[4-[(Z)-2-cyano-3-[(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-tert-butylbenzoate (PubChem CID 170913554) has the molecular formula C25H24N4O6S2 and a molecular weight of 540.62 g/mol. Its IUPAC name is [4-[(Z)-2-cyano-3-[(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-tert-butylbenzoate.
| Compound Name | [4-[(Z)-2-cyano-3-[(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 170913554 |
| Molecular Formula | C25H24N4O6S2 |
| Molecular Weight | 540.62 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | [4-[(Z)-2-cyano-3-[(5-methylsulfonyl-1,3,4-thiadiazol-2-yl)amino]-3-oxoprop-1-enyl]-2-methoxyphenyl] 4-tert-butylbenzoate |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2nnc(S(C)(=O)=O)s2)ccc1OC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H24N4O6S2/c1-25(2,3)18-9-7-16(8-10-18)22(31)35-19-11-6-15(13-20(19)34-4)12-17(14-26)21(30)27-23-28-29-24(36-23)37(5,32)33/h6-13H,1-5H3,(H,27,28,30)/b17-12- |
| InChIKey | QZVIINHTZSRMQS-ATVHPVEESA-N |
| XLogP | 4.01 |
| TPSA | 148.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.62 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|