C25H17ClN2O6 — CID 5004087
2-[[3-[3-(2-chlorobenzoyl)oxy-4-methoxyphenyl]-2-cyanoprop-2-enoyl]amino]benzoic acid (PubChem CID 5004087) has the molecular formula C25H17ClN2O6 and a molecular weight of 476.87 g/mol. Its IUPAC name is 2-[[3-[3-(2-chlorobenzoyl)oxy-4-methoxyphenyl]-2-cyanoprop-2-enoyl]amino]benzoic acid.
| Compound Name | 2-[[3-[3-(2-chlorobenzoyl)oxy-4-methoxyphenyl]-2-cyanoprop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 5004087 |
| Molecular Formula | C25H17ClN2O6 |
| Molecular Weight | 476.87 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | 2-[[3-[3-(2-chlorobenzoyl)oxy-4-methoxyphenyl]-2-cyanoprop-2-enoyl]amino]benzoic acid |
| SMILES | COc1ccc(C=C(C#N)C(=O)Nc2ccccc2C(=O)O)cc1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C25H17ClN2O6/c1-33-21-11-10-15(13-22(21)34-25(32)17-6-2-4-8-19(17)26)12-16(14-27)23(29)28-20-9-5-3-7-18(20)24(30)31/h2-13H,1H3,(H,28,29)(H,30,31) |
| InChIKey | FTZXROVOCGIXGW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 125.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.87 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|