C24H16Cl4N2O3 — CID 124534516
(Z)-2-cyano-N-(2,3-dichlorophenyl)-3-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enamide (PubChem CID 124534516) has the molecular formula C24H16Cl4N2O3 and a molecular weight of 522.22 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 124534516 |
| Molecular Formula | C24H16Cl4N2O3 |
| Molecular Weight | 522.22 g/mol |
| Exact Mass | 519.99 |
| IUPAC Name | (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]prop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2cccc(Cl)c2Cl)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H16Cl4N2O3/c1-32-22-11-14(6-8-21(22)33-13-15-5-7-17(25)19(27)10-15)9-16(12-29)24(31)30-20-4-2-3-18(26)23(20)28/h2-11H,13H2,1H3,(H,30,31)/b16-9- |
| InChIKey | QPCRGBYNURCMJM-SXGWCWSVSA-N |
| XLogP | 7.43 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.22 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|