C23H13Cl4IN2O2 — CID 124602577
(Z)-2-cyano-N-(2,3-dichlorophenyl)-3-[4-[(3,4-dichlorophenyl)methoxy]-3-iodophenyl]prop-2-enamide (PubChem CID 124602577) has the molecular formula C23H13Cl4IN2O2 and a molecular weight of 618.09 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-[4-[(3,4-dichlorophenyl)methoxy]-3-iodophenyl]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-[4-[(3,4-dichlorophenyl)methoxy]-3-iodophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 124602577 |
| Molecular Formula | C23H13Cl4IN2O2 |
| Molecular Weight | 618.09 g/mol |
| Exact Mass | 615.88 |
| IUPAC Name | (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-[4-[(3,4-dichlorophenyl)methoxy]-3-iodophenyl]prop-2-enamide |
| SMILES | N#C/C(=C/c1ccc(OCc2ccc(Cl)c(Cl)c2)c(I)c1)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C23H13Cl4IN2O2/c24-16-6-4-14(9-18(16)26)12-32-21-7-5-13(10-19(21)28)8-15(11-29)23(31)30-20-3-1-2-17(25)22(20)27/h1-10H,12H2,(H,30,31)/b15-8- |
| InChIKey | JJNDEFSCNGBONF-NVNXTCNLSA-N |
| XLogP | 8.03 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.09 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|