C24H16BrCl2IN2O2 — CID 124602566
(Z)-3-[3-bromo-5-iodo-4-[(3-methylphenyl)methoxy]phenyl]-2-cyano-N-(2,3-dichlorophenyl)prop-2-enamide (PubChem CID 124602566) has the molecular formula C24H16BrCl2IN2O2 and a molecular weight of 642.12 g/mol. Its IUPAC name is (Z)-3-[3-bromo-5-iodo-4-[(3-methylphenyl)methoxy]phenyl]-2-cyano-N-(2,3-dichlorophenyl)prop-2-enamide.
| Compound Name | (Z)-3-[3-bromo-5-iodo-4-[(3-methylphenyl)methoxy]phenyl]-2-cyano-N-(2,3-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 124602566 |
| Molecular Formula | C24H16BrCl2IN2O2 |
| Molecular Weight | 642.12 g/mol |
| Exact Mass | 639.88 |
| IUPAC Name | (Z)-3-[3-bromo-5-iodo-4-[(3-methylphenyl)methoxy]phenyl]-2-cyano-N-(2,3-dichlorophenyl)prop-2-enamide |
| SMILES | Cc1cccc(COc2c(Br)cc(/C=C(/C#N)C(=O)Nc3cccc(Cl)c3Cl)cc2I)c1 |
| InChI | InChI=1S/C24H16BrCl2IN2O2/c1-14-4-2-5-15(8-14)13-32-23-18(25)10-16(11-20(23)28)9-17(12-29)24(31)30-21-7-3-6-19(26)22(21)27/h2-11H,13H2,1H3,(H,30,31)/b17-9- |
| InChIKey | NUWRWVPBGBPFPE-MFOYZWKCSA-N |
| XLogP | 7.79 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.12 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|