C23H15Br2IN2O2 — CID 75409128
(Z)-2-cyano-3-(3,5-dibromo-4-phenylmethoxyphenyl)-N-(2-iodophenyl)prop-2-enamide (PubChem CID 75409128) has the molecular formula C23H15Br2IN2O2 and a molecular weight of 638.10 g/mol. Its IUPAC name is (Z)-2-cyano-3-(3,5-dibromo-4-phenylmethoxyphenyl)-N-(2-iodophenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(3,5-dibromo-4-phenylmethoxyphenyl)-N-(2-iodophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 75409128 |
| Molecular Formula | C23H15Br2IN2O2 |
| Molecular Weight | 638.10 g/mol |
| Exact Mass | 635.85 |
| IUPAC Name | (Z)-2-cyano-3-(3,5-dibromo-4-phenylmethoxyphenyl)-N-(2-iodophenyl)prop-2-enamide |
| SMILES | N#C/C(=C/c1cc(Br)c(OCc2ccccc2)c(Br)c1)C(=O)Nc1ccccc1I |
| InChI | InChI=1S/C23H15Br2IN2O2/c24-18-11-16(12-19(25)22(18)30-14-15-6-2-1-3-7-15)10-17(13-27)23(29)28-21-9-5-4-8-20(21)26/h1-12H,14H2,(H,28,29)/b17-10- |
| InChIKey | NAAUAPGBVZFYRI-YVLHZVERSA-N |
| XLogP | 6.94 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.10 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|