C18H13I3N2O2 — CID 75409122
(Z)-2-cyano-3-(4-ethoxy-3,5-diiodophenyl)-N-(2-iodophenyl)prop-2-enamide (PubChem CID 75409122) has the molecular formula C18H13I3N2O2 and a molecular weight of 670.03 g/mol. Its IUPAC name is (Z)-2-cyano-3-(4-ethoxy-3,5-diiodophenyl)-N-(2-iodophenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(4-ethoxy-3,5-diiodophenyl)-N-(2-iodophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 75409122 |
| Molecular Formula | C18H13I3N2O2 |
| Molecular Weight | 670.03 g/mol |
| Exact Mass | 669.81 |
| IUPAC Name | (Z)-2-cyano-3-(4-ethoxy-3,5-diiodophenyl)-N-(2-iodophenyl)prop-2-enamide |
| SMILES | CCOc1c(I)cc(/C=C(/C#N)C(=O)Nc2ccccc2I)cc1I |
| InChI | InChI=1S/C18H13I3N2O2/c1-2-25-17-14(20)8-11(9-15(17)21)7-12(10-22)18(24)23-16-6-4-3-5-13(16)19/h3-9H,2H2,1H3,(H,23,24)/b12-7- |
| InChIKey | RWORPWLOCGYBQS-GHXNOFRVSA-N |
| XLogP | 5.44 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.03 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|