C18H12Cl2I2N2O2 — CID 4051910
2-cyano-N-(3,5-dichlorophenyl)-3-(4-ethoxy-3,5-diiodophenyl)prop-2-enamide (PubChem CID 4051910) has the molecular formula C18H12Cl2I2N2O2 and a molecular weight of 613.02 g/mol. Its IUPAC name is 2-cyano-N-(3,5-dichlorophenyl)-3-(4-ethoxy-3,5-diiodophenyl)prop-2-enamide.
| Compound Name | 2-cyano-N-(3,5-dichlorophenyl)-3-(4-ethoxy-3,5-diiodophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4051910 |
| Molecular Formula | C18H12Cl2I2N2O2 |
| Molecular Weight | 613.02 g/mol |
| Exact Mass | 611.84 |
| IUPAC Name | 2-cyano-N-(3,5-dichlorophenyl)-3-(4-ethoxy-3,5-diiodophenyl)prop-2-enamide |
| SMILES | CCOc1c(I)cc(C=C(C#N)C(=O)Nc2cc(Cl)cc(Cl)c2)cc1I |
| InChI | InChI=1S/C18H12Cl2I2N2O2/c1-2-26-17-15(21)4-10(5-16(17)22)3-11(9-23)18(25)24-14-7-12(19)6-13(20)8-14/h3-8H,2H2,1H3,(H,24,25) |
| InChIKey | CENGNPGCCBFVQK-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.02 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|