C20H16I2N2O4 — CID 5293270
methyl 2-[[(E)-2-cyano-3-(4-ethoxy-3,5-diiodophenyl)prop-2-enoyl]amino]benzoate (PubChem CID 5293270) has the molecular formula C20H16I2N2O4 and a molecular weight of 602.17 g/mol. Its IUPAC name is methyl 2-[[(E)-2-cyano-3-(4-ethoxy-3,5-diiodophenyl)prop-2-enoyl]amino]benzoate.
| Compound Name | methyl 2-[[(E)-2-cyano-3-(4-ethoxy-3,5-diiodophenyl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 5293270 |
| Molecular Formula | C20H16I2N2O4 |
| Molecular Weight | 602.17 g/mol |
| Exact Mass | 601.92 |
| IUPAC Name | methyl 2-[[(E)-2-cyano-3-(4-ethoxy-3,5-diiodophenyl)prop-2-enoyl]amino]benzoate |
| SMILES | CCOc1c(I)cc(/C=C(\C#N)C(=O)Nc2ccccc2C(=O)OC)cc1I |
| InChI | InChI=1S/C20H16I2N2O4/c1-3-28-18-15(21)9-12(10-16(18)22)8-13(11-23)19(25)24-17-7-5-4-6-14(17)20(26)27-2/h4-10H,3H2,1-2H3,(H,24,25)/b13-8+ |
| InChIKey | ORLNKZSAKHHVLV-MDWZMJQESA-N |
| XLogP | 4.63 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.17 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|