C28H23BrN2O7 — CID 2350340
methyl 2-[[(Z)-3-[3-bromo-5-ethoxy-4-(4-methoxybenzoyl)oxyphenyl]-2-cyanoprop-2-enoyl]amino]benzoate (PubChem CID 2350340) has the molecular formula C28H23BrN2O7 and a molecular weight of 579.40 g/mol. Its IUPAC name is methyl 2-[[(Z)-3-[3-bromo-5-ethoxy-4-(4-methoxybenzoyl)oxyphenyl]-2-cyanoprop-2-enoyl]amino]benzoate.
| Compound Name | methyl 2-[[(Z)-3-[3-bromo-5-ethoxy-4-(4-methoxybenzoyl)oxyphenyl]-2-cyanoprop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 2350340 |
| Molecular Formula | C28H23BrN2O7 |
| Molecular Weight | 579.40 g/mol |
| Exact Mass | 578.07 |
| IUPAC Name | methyl 2-[[(Z)-3-[3-bromo-5-ethoxy-4-(4-methoxybenzoyl)oxyphenyl]-2-cyanoprop-2-enoyl]amino]benzoate |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2ccccc2C(=O)OC)cc(Br)c1OC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H23BrN2O7/c1-4-37-24-15-17(14-22(29)25(24)38-27(33)18-9-11-20(35-2)12-10-18)13-19(16-30)26(32)31-23-8-6-5-7-21(23)28(34)36-3/h5-15H,4H2,1-3H3,(H,31,32)/b19-13- |
| InChIKey | FPDGDGSTXNUFML-UYRXBGFRSA-N |
| XLogP | 5.41 |
| TPSA | 123.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.40 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|