C27H22IN3O7 — CID 6048029
[4-[(E)-2-cyano-3-(2-methyl-4-nitroanilino)-3-oxoprop-1-enyl]-2-ethoxy-6-iodophenyl] 4-methoxybenzoate (PubChem CID 6048029) has the molecular formula C27H22IN3O7 and a molecular weight of 627.39 g/mol. Its IUPAC name is [4-[(E)-2-cyano-3-(2-methyl-4-nitroanilino)-3-oxoprop-1-enyl]-2-ethoxy-6-iodophenyl] 4-methoxybenzoate.
| Compound Name | [4-[(E)-2-cyano-3-(2-methyl-4-nitroanilino)-3-oxoprop-1-enyl]-2-ethoxy-6-iodophenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 6048029 |
| Molecular Formula | C27H22IN3O7 |
| Molecular Weight | 627.39 g/mol |
| Exact Mass | 627.05 |
| IUPAC Name | [4-[(E)-2-cyano-3-(2-methyl-4-nitroanilino)-3-oxoprop-1-enyl]-2-ethoxy-6-iodophenyl] 4-methoxybenzoate |
| SMILES | CCOc1cc(/C=C(\C#N)C(=O)Nc2ccc([N+](=O)[O-])cc2C)cc(I)c1OC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H22IN3O7/c1-4-37-24-14-17(13-22(28)25(24)38-27(33)18-5-8-21(36-3)9-6-18)12-19(15-29)26(32)30-23-10-7-20(31(34)35)11-16(23)2/h5-14H,4H2,1-3H3,(H,30,32)/b19-12+ |
| InChIKey | SYOUTSVXTZJDSJ-XDHOZWIPSA-N |
| XLogP | 5.68 |
| TPSA | 140.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.39 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|