C19H16IN3O5 — CID 75409092
(Z)-2-cyano-3-(3-ethoxy-5-iodo-4-methoxyphenyl)-N-(2-nitrophenyl)prop-2-enamide (PubChem CID 75409092) has the molecular formula C19H16IN3O5 and a molecular weight of 493.26 g/mol. Its IUPAC name is (Z)-2-cyano-3-(3-ethoxy-5-iodo-4-methoxyphenyl)-N-(2-nitrophenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(3-ethoxy-5-iodo-4-methoxyphenyl)-N-(2-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 75409092 |
| Molecular Formula | C19H16IN3O5 |
| Molecular Weight | 493.26 g/mol |
| Exact Mass | 493.01 |
| IUPAC Name | (Z)-2-cyano-3-(3-ethoxy-5-iodo-4-methoxyphenyl)-N-(2-nitrophenyl)prop-2-enamide |
| SMILES | CCOc1cc(/C=C(/C#N)C(=O)Nc2ccccc2[N+](=O)[O-])cc(I)c1OC |
| InChI | InChI=1S/C19H16IN3O5/c1-3-28-17-10-12(9-14(20)18(17)27-2)8-13(11-21)19(24)22-15-6-4-5-7-16(15)23(25)26/h4-10H,3H2,1-2H3,(H,22,24)/b13-8- |
| InChIKey | LIWUKAXEOUWQAU-JYRVWZFOSA-N |
| XLogP | 4.15 |
| TPSA | 114.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.26 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|