C18H14I2N2O3 — CID 75409094
(Z)-2-cyano-3-(3-iodo-4,5-dimethoxyphenyl)-N-(2-iodophenyl)prop-2-enamide (PubChem CID 75409094) has the molecular formula C18H14I2N2O3 and a molecular weight of 560.13 g/mol. Its IUPAC name is (Z)-2-cyano-3-(3-iodo-4,5-dimethoxyphenyl)-N-(2-iodophenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(3-iodo-4,5-dimethoxyphenyl)-N-(2-iodophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 75409094 |
| Molecular Formula | C18H14I2N2O3 |
| Molecular Weight | 560.13 g/mol |
| Exact Mass | 559.91 |
| IUPAC Name | (Z)-2-cyano-3-(3-iodo-4,5-dimethoxyphenyl)-N-(2-iodophenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nc2ccccc2I)cc(I)c1OC |
| InChI | InChI=1S/C18H14I2N2O3/c1-24-16-9-11(8-14(20)17(16)25-2)7-12(10-21)18(23)22-15-6-4-3-5-13(15)19/h3-9H,1-2H3,(H,22,23)/b12-7- |
| InChIKey | HDSCOGSLEWFIPF-GHXNOFRVSA-N |
| XLogP | 4.46 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.13 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|