C18H18IN3O3 — CID 126393474
(Z)-2-cyano-N-(2,5-dimethylpyrrol-1-yl)-3-(3-iodo-4,5-dimethoxyphenyl)prop-2-enamide (PubChem CID 126393474) has the molecular formula C18H18IN3O3 and a molecular weight of 451.26 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,5-dimethylpyrrol-1-yl)-3-(3-iodo-4,5-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,5-dimethylpyrrol-1-yl)-3-(3-iodo-4,5-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 126393474 |
| Molecular Formula | C18H18IN3O3 |
| Molecular Weight | 451.26 g/mol |
| Exact Mass | 451.04 |
| IUPAC Name | (Z)-2-cyano-N-(2,5-dimethylpyrrol-1-yl)-3-(3-iodo-4,5-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C(/C#N)C(=O)Nn2c(C)ccc2C)cc(I)c1OC |
| InChI | InChI=1S/C18H18IN3O3/c1-11-5-6-12(2)22(11)21-18(23)14(10-20)7-13-8-15(19)17(25-4)16(9-13)24-3/h5-9H,1-4H3,(H,21,23)/b14-7- |
| InChIKey | YCGKHXIQGDMTIT-AUWJEWJLSA-N |
| XLogP | 3.40 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.26 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|