C27H21I2N3O2 — CID 126380182
(Z)-2-cyano-3-[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]-N-(2,5-dimethylpyrrol-1-yl)prop-2-enamide (PubChem CID 126380182) has the molecular formula C27H21I2N3O2 and a molecular weight of 673.29 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]-N-(2,5-dimethylpyrrol-1-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]-N-(2,5-dimethylpyrrol-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 126380182 |
| Molecular Formula | C27H21I2N3O2 |
| Molecular Weight | 673.29 g/mol |
| Exact Mass | 672.97 |
| IUPAC Name | (Z)-2-cyano-3-[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]-N-(2,5-dimethylpyrrol-1-yl)prop-2-enamide |
| SMILES | Cc1ccc(C)n1NC(=O)/C(C#N)=C\c1cc(I)c(OCc2cccc3ccccc23)c(I)c1 |
| InChI | InChI=1S/C27H21I2N3O2/c1-17-10-11-18(2)32(17)31-27(33)22(15-30)12-19-13-24(28)26(25(29)14-19)34-16-21-8-5-7-20-6-3-4-9-23(20)21/h3-14H,16H2,1-2H3,(H,31,33)/b22-12- |
| InChIKey | MTWOTIZKULABNN-UUYOSTAYSA-N |
| XLogP | 6.72 |
| TPSA | 67.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.29 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|